About 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite
2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite (PubChem CID 167468344) has the molecular formula C7H10INO2S
and a molecular weight of 299.13 g/mol. Its IUPAC name is 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite.
Molecular Properties
| Compound Name | 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite |
| PubChem CID | 167468344 |
| Molecular Formula | C7H10INO2S |
| Molecular Weight | 299.13 g/mol |
| Exact Mass | 298.95 |
| IUPAC Name | 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite |
| SMILES | OC1(C#CSI)CNCCOC1 |
| InChI | InChI=1S/C7H10INO2S/c8-12-4-1-7(10)5-9-2-3-11-6-7/h9-10H,2-3,5-6H2 |
| InChIKey | IDTRLMCKIXFLHX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.13 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite?
The IUPAC name of 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite (CID 167468344) is 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite.
What is the SMILES notation for 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite?
The canonical SMILES for 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite is OC1(C#CSI)CNCCOC1.
What is the InChIKey of 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite?
The InChIKey is IDTRLMCKIXFLHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10INO2S/c8-12-4-1-7(10)5-9-2-3-11-6-7/h9-10H,2-3,5-6H2.
What are the key properties of 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite?
2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite has a molecular weight of 299.13 g/mol, XLogP of 0.38, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-hydroxy-1,4-oxazepan-6-yl)ethynyl thiohypoiodite is sourced from PubChem (CID 167468344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).