C20H33NO4S — CID 167473228
1,2-dimethoxy-4-(2-methyl-1-octylsulfanylpropyl)-5-nitrobenzene (PubChem CID 167473228) has the molecular formula C20H33NO4S and a molecular weight of 383.55 g/mol. Its IUPAC name is 1,2-dimethoxy-4-(2-methyl-1-octylsulfanylpropyl)-5-nitrobenzene.
| Compound Name | 1,2-dimethoxy-4-(2-methyl-1-octylsulfanylpropyl)-5-nitrobenzene |
|---|---|
| PubChem CID | 167473228 |
| Molecular Formula | C20H33NO4S |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1,2-dimethoxy-4-(2-methyl-1-octylsulfanylpropyl)-5-nitrobenzene |
| SMILES | CCCCCCCCSC(c1cc(OC)c(OC)cc1[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C20H33NO4S/c1-6-7-8-9-10-11-12-26-20(15(2)3)16-13-18(24-4)19(25-5)14-17(16)21(22)23/h13-15,20H,6-12H2,1-5H3 |
| InChIKey | HCMFTMGUDXZEED-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|