C42H48N4O4 — CID 167478456
benzene;3-[1-methyl-6-[1-(2-phenoxyethyl)piperidin-4-yl]oxyindazol-3-yl]piperidine-2,6-dione;1,2,3,4-tetrahydronaphthalene (PubChem CID 167478456) has the molecular formula C42H48N4O4 and a molecular weight of 672.87 g/mol. Its IUPAC name is benzene;3-[1-methyl-6-[1-(2-phenoxyethyl)piperidin-4-yl]oxyindazol-3-yl]piperidine-2,6-dione;1,2,3,4-tetrahydronaphthalene.
| Compound Name | benzene;3-[1-methyl-6-[1-(2-phenoxyethyl)piperidin-4-yl]oxyindazol-3-yl]piperidine-2,6-dione;1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 167478456 |
| Molecular Formula | C42H48N4O4 |
| Molecular Weight | 672.87 g/mol |
| Exact Mass | 672.37 |
| IUPAC Name | benzene;3-[1-methyl-6-[1-(2-phenoxyethyl)piperidin-4-yl]oxyindazol-3-yl]piperidine-2,6-dione;1,2,3,4-tetrahydronaphthalene |
| SMILES | Cn1nc(C2CCC(=O)NC2=O)c2ccc(OC3CCN(CCOc4ccccc4)CC3)cc21.c1ccc2c(c1)CCCC2.c1ccccc1 |
| InChI | InChI=1S/C26H30N4O4.C10H12.C6H6/c1-29-23-17-20(7-8-21(23)25(28-29)22-9-10-24(31)27-26(22)32)34-19-11-13-30(14-12-19)15-16-33-18-5-3-2-4-6-18;1-2-6-10-8-4-3-7-9(10)5-1;1-2-4-6-5-3-1/h2-8,17,19,22H,9-16H2,1H3,(H,27,31,32);1-2,5-6H,3-4,7-8H2;1-6H |
| InChIKey | FOZJPSUCTQTKBW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.87 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|