C45H48N6O5 — CID 167478832
3-[1-methyl-7-[2-[4-[4-[4-[(3-methyl-2-phenylindol-1-yl)methyl]phenoxy]butyl]piperazin-1-yl]-2-oxoethoxy]indazol-3-yl]piperidine-2,6-dione (PubChem CID 167478832) has the molecular formula C45H48N6O5 and a molecular weight of 752.92 g/mol. Its IUPAC name is 3-[1-methyl-7-[2-[4-[4-[4-[(3-methyl-2-phenylindol-1-yl)methyl]phenoxy]butyl]piperazin-1-yl]-2-oxoethoxy]indazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[1-methyl-7-[2-[4-[4-[4-[(3-methyl-2-phenylindol-1-yl)methyl]phenoxy]butyl]piperazin-1-yl]-2-oxoethoxy]indazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167478832 |
| Molecular Formula | C45H48N6O5 |
| Molecular Weight | 752.92 g/mol |
| Exact Mass | 752.37 |
| IUPAC Name | 3-[1-methyl-7-[2-[4-[4-[4-[(3-methyl-2-phenylindol-1-yl)methyl]phenoxy]butyl]piperazin-1-yl]-2-oxoethoxy]indazol-3-yl]piperidine-2,6-dione |
| SMILES | Cc1c(-c2ccccc2)n(Cc2ccc(OCCCCN3CCN(C(=O)COc4cccc5c(C6CCC(=O)NC6=O)nn(C)c45)CC3)cc2)c2ccccc12 |
| InChI | InChI=1S/C45H48N6O5/c1-31-35-13-6-7-15-38(35)51(43(31)33-11-4-3-5-12-33)29-32-17-19-34(20-18-32)55-28-9-8-23-49-24-26-50(27-25-49)41(53)30-56-39-16-10-14-36-42(47-48(2)44(36)39)37-21-22-40(52)46-45(37)54/h3-7,10-20,37H,8-9,21-30H2,1-2H3,(H,46,52,54) |
| InChIKey | CKTZQVHGWLBJJD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.92 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|