C51H58N4O5 — CID 167478994
1-[4-[2-[4-[4-[4-(6-benzyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]butyl]piperazin-1-yl]-2-oxoethoxy]phenyl]-1,3-diazinane-2,4-dione;ethane (PubChem CID 167478994) has the molecular formula C51H58N4O5 and a molecular weight of 807.05 g/mol. Its IUPAC name is 1-[4-[2-[4-[4-[4-(6-benzyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]butyl]piperazin-1-yl]-2-oxoethoxy]phenyl]-1,3-diazinane-2,4-dione;ethane.
| Compound Name | 1-[4-[2-[4-[4-[4-(6-benzyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]butyl]piperazin-1-yl]-2-oxoethoxy]phenyl]-1,3-diazinane-2,4-dione;ethane |
|---|---|
| PubChem CID | 167478994 |
| Molecular Formula | C51H58N4O5 |
| Molecular Weight | 807.05 g/mol |
| Exact Mass | 806.44 |
| IUPAC Name | 1-[4-[2-[4-[4-[4-(6-benzyl-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]butyl]piperazin-1-yl]-2-oxoethoxy]phenyl]-1,3-diazinane-2,4-dione;ethane |
| SMILES | CC.O=C1CCN(c2ccc(OCC(=O)N3CCN(CCCCOc4ccc(C5c6ccc(Cc7ccccc7)cc6CCC5c5ccccc5)cc4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C49H52N4O5.C2H6/c54-46-25-27-53(49(56)50-46)41-17-21-43(22-18-41)58-35-47(55)52-30-28-51(29-31-52)26-7-8-32-57-42-19-14-39(15-20-42)48-44(38-11-5-2-6-12-38)24-16-40-34-37(13-23-45(40)48)33-36-9-3-1-4-10-36;1-2/h1-6,9-15,17-23,34,44,48H,7-8,16,24-33,35H2,(H,50,54,56);1-2H3 |
| InChIKey | BWGIITLZBCMASJ-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.05 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|