C42H46N4O5 — CID 167478437
1-[3-[2-oxo-2-[4-[4-[4-(2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]butyl]piperazin-1-yl]ethoxy]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 167478437) has the molecular formula C42H46N4O5 and a molecular weight of 686.85 g/mol. Its IUPAC name is 1-[3-[2-oxo-2-[4-[4-[4-(2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]butyl]piperazin-1-yl]ethoxy]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[3-[2-oxo-2-[4-[4-[4-(2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]butyl]piperazin-1-yl]ethoxy]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 167478437 |
| Molecular Formula | C42H46N4O5 |
| Molecular Weight | 686.85 g/mol |
| Exact Mass | 686.35 |
| IUPAC Name | 1-[3-[2-oxo-2-[4-[4-[4-(2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]butyl]piperazin-1-yl]ethoxy]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2cccc(OCC(=O)N3CCN(CCCCOc4ccc(C5c6ccccc6CCC5c5ccccc5)cc4)CC3)c2)C(=O)N1 |
| InChI | InChI=1S/C42H46N4O5/c47-39-21-23-46(42(49)43-39)34-12-8-13-36(29-34)51-30-40(48)45-26-24-44(25-27-45)22-6-7-28-50-35-18-15-33(16-19-35)41-37-14-5-4-11-32(37)17-20-38(41)31-9-2-1-3-10-31/h1-5,8-16,18-19,29,38,41H,6-7,17,20-28,30H2,(H,43,47,49) |
| InChIKey | WHIFGHLMLTWRAS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.85 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|