C44H34N4O — CID 167485293
5-[4-(6-benzo[a]anthracen-7-yl-5-methyl-2-phenyl-4,5-dihydropyrimidin-4-yl)phenyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 167485293) has the molecular formula C44H34N4O and a molecular weight of 634.78 g/mol. Its IUPAC name is 5-[4-(6-benzo[a]anthracen-7-yl-5-methyl-2-phenyl-4,5-dihydropyrimidin-4-yl)phenyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[4-(6-benzo[a]anthracen-7-yl-5-methyl-2-phenyl-4,5-dihydropyrimidin-4-yl)phenyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 167485293 |
| Molecular Formula | C44H34N4O |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | 5-[4-(6-benzo[a]anthracen-7-yl-5-methyl-2-phenyl-4,5-dihydropyrimidin-4-yl)phenyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | CC1C(c2c3ccccc3cc3c2ccc2ccccc23)=NC(c2ccccc2)=NC1c1ccc(-c2ccc3c(c2)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C44H34N4O/c1-27-41(30-19-17-28(18-20-30)32-22-24-38-39(26-32)48(3)44(49)47(38)2)45-43(31-12-5-4-6-13-31)46-42(27)40-35-16-10-8-14-33(35)25-37-34-15-9-7-11-29(34)21-23-36(37)40/h4-27,41H,1-3H3 |
| InChIKey | ZQWWXAZVWUPHCX-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 51.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|