C12H24N2 — CID 167486388
(2Z,4Z)-1-N-ethyl-1-N,2-N,2-N-trimethylhepta-2,4-diene-1,2-diamine (PubChem CID 167486388) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (2Z,4Z)-1-N-ethyl-1-N,2-N,2-N-trimethylhepta-2,4-diene-1,2-diamine.
| Compound Name | (2Z,4Z)-1-N-ethyl-1-N,2-N,2-N-trimethylhepta-2,4-diene-1,2-diamine |
|---|---|
| PubChem CID | 167486388 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (2Z,4Z)-1-N-ethyl-1-N,2-N,2-N-trimethylhepta-2,4-diene-1,2-diamine |
| SMILES | CC/C=C\C=C(\CN(C)CC)N(C)C |
| InChI | InChI=1S/C12H24N2/c1-6-8-9-10-12(13(3)4)11-14(5)7-2/h8-10H,6-7,11H2,1-5H3/b9-8-,12-10- |
| InChIKey | MZQDUOCBIZHWGG-DMGFJBLZSA-N |
| XLogP | 2.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|