C16H28FN — CID 167488547
N-butyl-N-ethyl-3-fluoro-4,5-dimethylaniline;ethane (PubChem CID 167488547) has the molecular formula C16H28FN and a molecular weight of 253.40 g/mol. Its IUPAC name is N-butyl-N-ethyl-3-fluoro-4,5-dimethylaniline;ethane.
| Compound Name | N-butyl-N-ethyl-3-fluoro-4,5-dimethylaniline;ethane |
|---|---|
| PubChem CID | 167488547 |
| Molecular Formula | C16H28FN |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N-butyl-N-ethyl-3-fluoro-4,5-dimethylaniline;ethane |
| SMILES | CC.CCCCN(CC)c1cc(C)c(C)c(F)c1 |
| InChI | InChI=1S/C14H22FN.C2H6/c1-5-7-8-16(6-2)13-9-11(3)12(4)14(15)10-13;1-2/h9-10H,5-8H2,1-4H3;1-2H3 |
| InChIKey | SLTKJZHXRKVTES-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |