C15H29NS — CID 163242602
N-butyl-3,5-dimethyl-N-propylthiophen-2-amine;ethane (PubChem CID 163242602) has the molecular formula C15H29NS and a molecular weight of 255.47 g/mol. Its IUPAC name is N-butyl-3,5-dimethyl-N-propylthiophen-2-amine;ethane.
| Compound Name | N-butyl-3,5-dimethyl-N-propylthiophen-2-amine;ethane |
|---|---|
| PubChem CID | 163242602 |
| Molecular Formula | C15H29NS |
| Molecular Weight | 255.47 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | N-butyl-3,5-dimethyl-N-propylthiophen-2-amine;ethane |
| SMILES | CC.CCCCN(CCC)c1sc(C)cc1C |
| InChI | InChI=1S/C13H23NS.C2H6/c1-5-7-9-14(8-6-2)13-11(3)10-12(4)15-13;1-2/h10H,5-9H2,1-4H3;1-2H3 |
| InChIKey | XBCOUSDHRVZCQM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |