C17H15N5OS3 — CID 16751114
1-[(4-amino-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carbonyl)amino]-3-phenylthiourea (PubChem CID 16751114) has the molecular formula C17H15N5OS3 and a molecular weight of 401.54 g/mol. Its IUPAC name is 1-[(4-amino-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carbonyl)amino]-3-phenylthiourea.
| Compound Name | 1-[(4-amino-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carbonyl)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 16751114 |
| Molecular Formula | C17H15N5OS3 |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 1-[(4-amino-3-phenyl-2-sulfanylidene-1,3-thiazole-5-carbonyl)amino]-3-phenylthiourea |
| SMILES | Nc1c(C(=O)NNC(=S)Nc2ccccc2)sc(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C17H15N5OS3/c18-14-13(26-17(25)22(14)12-9-5-2-6-10-12)15(23)20-21-16(24)19-11-7-3-1-4-8-11/h1-10H,18H2,(H,20,23)(H2,19,21,24) |
| InChIKey | CDSLYAPYGMLZPS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|