C16H15BrO2 — CID 16751285
4-(6-bromo-2-methyl-3,4-dihydro-2H-chromen-4-yl)phenol (PubChem CID 16751285) has the molecular formula C16H15BrO2 and a molecular weight of 319.20 g/mol. Its IUPAC name is 4-(6-bromo-2-methyl-3,4-dihydro-2H-chromen-4-yl)phenol.
| Compound Name | 4-(6-bromo-2-methyl-3,4-dihydro-2H-chromen-4-yl)phenol |
|---|---|
| PubChem CID | 16751285 |
| Molecular Formula | C16H15BrO2 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 4-(6-bromo-2-methyl-3,4-dihydro-2H-chromen-4-yl)phenol |
| SMILES | CC1CC(c2ccc(O)cc2)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C16H15BrO2/c1-10-8-14(11-2-5-13(18)6-3-11)15-9-12(17)4-7-16(15)19-10/h2-7,9-10,14,18H,8H2,1H3 |
| InChIKey | CHJXQWPZINSJHI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |