C20H23FN4O4 — CID 167513297
2-[2-(2,6-dioxopiperidin-3-yl)ethyl]-5-fluoro-6-(4-methylpiperazin-1-yl)isoindole-1,3-dione (PubChem CID 167513297) has the molecular formula C20H23FN4O4 and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)ethyl]-5-fluoro-6-(4-methylpiperazin-1-yl)isoindole-1,3-dione.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)ethyl]-5-fluoro-6-(4-methylpiperazin-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167513297 |
| Molecular Formula | C20H23FN4O4 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)ethyl]-5-fluoro-6-(4-methylpiperazin-1-yl)isoindole-1,3-dione |
| SMILES | CN1CCN(c2cc3c(cc2F)C(=O)N(CCC2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C20H23FN4O4/c1-23-6-8-24(9-7-23)16-11-14-13(10-15(16)21)19(28)25(20(14)29)5-4-12-2-3-17(26)22-18(12)27/h10-12H,2-9H2,1H3,(H,22,26,27) |
| InChIKey | JHJCHWXZPBHGQE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|