C26H31NO4 — CID 16751754
diethyl 3-methylidene-4-(2-phenyl-4,5,6,7-tetrahydroisoindol-1-yl)cyclopentane-1,1-dicarboxylate (PubChem CID 16751754) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is diethyl 3-methylidene-4-(2-phenyl-4,5,6,7-tetrahydroisoindol-1-yl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-methylidene-4-(2-phenyl-4,5,6,7-tetrahydroisoindol-1-yl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 16751754 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | diethyl 3-methylidene-4-(2-phenyl-4,5,6,7-tetrahydroisoindol-1-yl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)CC1c1c2c(cn1-c1ccccc1)CCCC2 |
| InChI | InChI=1S/C26H31NO4/c1-4-30-24(28)26(25(29)31-5-2)15-18(3)22(16-26)23-21-14-10-9-11-19(21)17-27(23)20-12-7-6-8-13-20/h6-8,12-13,17,22H,3-5,9-11,14-16H2,1-2H3 |
| InChIKey | XKVSEMDRXNMESS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|