C23H38NO3P — CID 16752126
(1R,2R)-2-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylpropyl)-2-oxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinin-2-yl]-1-phenylpropan-1-ol (PubChem CID 16752126) has the molecular formula C23H38NO3P and a molecular weight of 407.54 g/mol. Its IUPAC name is (1R,2R)-2-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylpropyl)-2-oxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinin-2-yl]-1-phenylpropan-1-ol.
| Compound Name | (1R,2R)-2-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylpropyl)-2-oxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinin-2-yl]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 16752126 |
| Molecular Formula | C23H38NO3P |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | (1R,2R)-2-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylpropyl)-2-oxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinin-2-yl]-1-phenylpropan-1-ol |
| SMILES | CC(C)CN1C(C)(C)[C@@H]2CC[C@@H](C)C[C@H]2O[P@@]1(=O)[C@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H38NO3P/c1-16(2)15-24-23(5,6)20-13-12-17(3)14-21(20)27-28(24,26)18(4)22(25)19-10-8-7-9-11-19/h7-11,16-18,20-22,25H,12-15H2,1-6H3/t17-,18-,20-,21-,22+,28+/m1/s1 |
| InChIKey | QGUJOVAYYDGXBO-UCEVOWCLSA-N |
| XLogP | 5.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|