C31H38N4O5Si — CID 167524315
4-[[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]amino]-6-methoxypyrimidine-2-carbonitrile (PubChem CID 167524315) has the molecular formula C31H38N4O5Si and a molecular weight of 574.75 g/mol. Its IUPAC name is 4-[[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]amino]-6-methoxypyrimidine-2-carbonitrile.
| Compound Name | 4-[[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]amino]-6-methoxypyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 167524315 |
| Molecular Formula | C31H38N4O5Si |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 4-[[(3aR,4R,7S,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]amino]-6-methoxypyrimidine-2-carbonitrile |
| SMILES | COc1cc(N[C@H]2CO[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]3OC(C)(C)O[C@@H]32)nc(C#N)n1 |
| InChI | InChI=1S/C31H38N4O5Si/c1-30(2,3)41(21-13-9-7-10-14-21,22-15-11-8-12-16-22)38-20-24-29-28(39-31(4,5)40-29)23(19-37-24)33-25-17-27(36-6)35-26(18-32)34-25/h7-17,23-24,28-29H,19-20H2,1-6H3,(H,33,34,35)/t23-,24+,28+,29-/m0/s1 |
| InChIKey | OSEGLNOXQMDWEE-OTEJSBPHSA-N |
| XLogP | 3.63 |
| TPSA | 107.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|