C18H12N2O3 — CID 167525461
2-(2-methylphenyl)-1H-benzo[f]indazole-3,4,9-trione (PubChem CID 167525461) has the molecular formula C18H12N2O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1H-benzo[f]indazole-3,4,9-trione.
| Compound Name | 2-(2-methylphenyl)-1H-benzo[f]indazole-3,4,9-trione |
|---|---|
| PubChem CID | 167525461 |
| Molecular Formula | C18H12N2O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-(2-methylphenyl)-1H-benzo[f]indazole-3,4,9-trione |
| SMILES | Cc1ccccc1-n1[nH]c2c(c1=O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H12N2O3/c1-10-6-2-5-9-13(10)20-18(23)14-15(19-20)17(22)12-8-4-3-7-11(12)16(14)21/h2-9,19H,1H3 |
| InChIKey | WPVQKFCKLQELDC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|