C17H16N6O2 — CID 66495037
4-methyl-2-(2-methylphenyl)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione (PubChem CID 66495037) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 4-methyl-2-(2-methylphenyl)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione.
| Compound Name | 4-methyl-2-(2-methylphenyl)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
|---|---|
| PubChem CID | 66495037 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-methyl-2-(2-methylphenyl)-5-(5-methyl-1H-1,2,4-triazol-3-yl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
| SMILES | Cc1nc(-n2c(C)c3c(=O)n(-c4ccccc4C)[nH]c3cc2=O)n[nH]1 |
| InChI | InChI=1S/C17H16N6O2/c1-9-6-4-5-7-13(9)23-16(25)15-10(2)22(14(24)8-12(15)21-23)17-18-11(3)19-20-17/h4-8,21H,1-3H3,(H,18,19,20) |
| InChIKey | ZNHIKKFDBKOKNE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|