C14H13N3O — CID 167525947
4-(7-methoxy-1H-pyrrolo[2,3-c]pyridin-4-yl)aniline (PubChem CID 167525947) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 4-(7-methoxy-1H-pyrrolo[2,3-c]pyridin-4-yl)aniline.
| Compound Name | 4-(7-methoxy-1H-pyrrolo[2,3-c]pyridin-4-yl)aniline |
|---|---|
| PubChem CID | 167525947 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-(7-methoxy-1H-pyrrolo[2,3-c]pyridin-4-yl)aniline |
| SMILES | COc1ncc(-c2ccc(N)cc2)c2cc[nH]c12 |
| InChI | InChI=1S/C14H13N3O/c1-18-14-13-11(6-7-16-13)12(8-17-14)9-2-4-10(15)5-3-9/h2-8,16H,15H2,1H3 |
| InChIKey | ACFDRLFJXYLLER-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|