C46H50O5 — CID 16753224
[(1S,2S)-2-phenylmethoxy-1-[(1R,2R)-1,2,3-tris(phenylmethoxy)propyl]oct-3-ynoxy]methylbenzene (PubChem CID 16753224) has the molecular formula C46H50O5 and a molecular weight of 682.90 g/mol. Its IUPAC name is [(1S,2S)-2-phenylmethoxy-1-[(1R,2R)-1,2,3-tris(phenylmethoxy)propyl]oct-3-ynoxy]methylbenzene.
| Compound Name | [(1S,2S)-2-phenylmethoxy-1-[(1R,2R)-1,2,3-tris(phenylmethoxy)propyl]oct-3-ynoxy]methylbenzene |
|---|---|
| PubChem CID | 16753224 |
| Molecular Formula | C46H50O5 |
| Molecular Weight | 682.90 g/mol |
| Exact Mass | 682.37 |
| IUPAC Name | [(1S,2S)-2-phenylmethoxy-1-[(1R,2R)-1,2,3-tris(phenylmethoxy)propyl]oct-3-ynoxy]methylbenzene |
| SMILES | CCCCC#C[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C46H50O5/c1-2-3-4-20-31-43(48-33-39-23-12-6-13-24-39)45(50-35-41-27-16-8-17-28-41)46(51-36-42-29-18-9-19-30-42)44(49-34-40-25-14-7-15-26-40)37-47-32-38-21-10-5-11-22-38/h5-19,21-30,43-46H,2-4,32-37H2,1H3/t43-,44+,45-,46+/m0/s1 |
| InChIKey | JIOPYQJQKDMOMG-KGVCLGQBSA-N |
| XLogP | 9.74 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.90 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|