C12H9NO3 — CID 167537181
3,5-dioxo-N-phenylcyclopentene-1-carboxamide (PubChem CID 167537181) has the molecular formula C12H9NO3 and a molecular weight of 215.21 g/mol. Its IUPAC name is 3,5-dioxo-N-phenylcyclopentene-1-carboxamide.
| Compound Name | 3,5-dioxo-N-phenylcyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 167537181 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3,5-dioxo-N-phenylcyclopentene-1-carboxamide |
| SMILES | O=C1C=C(C(=O)Nc2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C12H9NO3/c14-9-6-10(11(15)7-9)12(16)13-8-4-2-1-3-5-8/h1-6H,7H2,(H,13,16) |
| InChIKey | OSSNUFKQEKYPCS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|