C14H16 — CID 167541438
2-cyclopropyl-5,6-dimethyl-1H-indene (PubChem CID 167541438) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-cyclopropyl-5,6-dimethyl-1H-indene.
| Compound Name | 2-cyclopropyl-5,6-dimethyl-1H-indene |
|---|---|
| PubChem CID | 167541438 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 2-cyclopropyl-5,6-dimethyl-1H-indene |
| SMILES | Cc1cc2c(cc1C)CC(C1CC1)=C2 |
| InChI | InChI=1S/C14H16/c1-9-5-12-7-14(11-3-4-11)8-13(12)6-10(9)2/h5-7,11H,3-4,8H2,1-2H3 |
| InChIKey | JTADBUYAWKHTHU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |