C9H13F2N3O — CID 167555491
5-(1,1-difluoroethyl)-1-[(3S)-oxolan-3-yl]pyrazol-3-amine (PubChem CID 167555491) has the molecular formula C9H13F2N3O and a molecular weight of 217.22 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-1-[(3S)-oxolan-3-yl]pyrazol-3-amine.
| Compound Name | 5-(1,1-difluoroethyl)-1-[(3S)-oxolan-3-yl]pyrazol-3-amine |
|---|---|
| PubChem CID | 167555491 |
| Molecular Formula | C9H13F2N3O |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 5-(1,1-difluoroethyl)-1-[(3S)-oxolan-3-yl]pyrazol-3-amine |
| SMILES | CC(F)(F)c1cc(N)nn1[C@H]1CCOC1 |
| InChI | InChI=1S/C9H13F2N3O/c1-9(10,11)7-4-8(12)13-14(7)6-2-3-15-5-6/h4,6H,2-3,5H2,1H3,(H2,12,13)/t6-/m0/s1 |
| InChIKey | IMPUHQJEGGRVNK-LURJTMIESA-N |
| XLogP | 1.54 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |