C9H16O2 — CID 16756947
(4S,5R)-5-methyloct-7-yne-1,4-diol (PubChem CID 16756947) has the molecular formula C9H16O2 and a molecular weight of 156.23 g/mol. Its IUPAC name is (4S,5R)-5-methyloct-7-yne-1,4-diol.
| Compound Name | (4S,5R)-5-methyloct-7-yne-1,4-diol |
|---|---|
| PubChem CID | 16756947 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (4S,5R)-5-methyloct-7-yne-1,4-diol |
| SMILES | C#CC[C@@H](C)[C@@H](O)CCCO |
| InChI | InChI=1S/C9H16O2/c1-3-5-8(2)9(11)6-4-7-10/h1,8-11H,4-7H2,2H3/t8-,9+/m1/s1 |
| InChIKey | ITCYMSHGRKLSLS-BDAKNGLRSA-N |
| XLogP | 0.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|