C5H12O2S2 — CID 89422392
5,5-bis(sulfanyl)pentane-1,4-diol (PubChem CID 89422392) has the molecular formula C5H12O2S2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 5,5-bis(sulfanyl)pentane-1,4-diol.
| Compound Name | 5,5-bis(sulfanyl)pentane-1,4-diol |
|---|---|
| PubChem CID | 89422392 |
| Molecular Formula | C5H12O2S2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 5,5-bis(sulfanyl)pentane-1,4-diol |
| SMILES | OCCCC(O)C(S)S |
| InChI | InChI=1S/C5H12O2S2/c6-3-1-2-4(7)5(8)9/h4-9H,1-3H2 |
| InChIKey | FUXNFBNIUXCHDK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|