C7H14O4S2 — CID 87666383
sulfanyl 4,7-dihydroxy-3-sulfanylheptanoate (PubChem CID 87666383) has the molecular formula C7H14O4S2 and a molecular weight of 226.32 g/mol. Its IUPAC name is sulfanyl 4,7-dihydroxy-3-sulfanylheptanoate.
| Compound Name | sulfanyl 4,7-dihydroxy-3-sulfanylheptanoate |
|---|---|
| PubChem CID | 87666383 |
| Molecular Formula | C7H14O4S2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | sulfanyl 4,7-dihydroxy-3-sulfanylheptanoate |
| SMILES | O=C(CC(S)C(O)CCCO)OS |
| InChI | InChI=1S/C7H14O4S2/c8-3-1-2-5(9)6(12)4-7(10)11-13/h5-6,8-9,12-13H,1-4H2 |
| InChIKey | RDLJDBAEQJMCAC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|