C11H23ClO4 — CID 123578018
6-chloro-5-(3-hydroxypropyl)octane-1,4,8-triol (PubChem CID 123578018) has the molecular formula C11H23ClO4 and a molecular weight of 254.75 g/mol. Its IUPAC name is 6-chloro-5-(3-hydroxypropyl)octane-1,4,8-triol.
| Compound Name | 6-chloro-5-(3-hydroxypropyl)octane-1,4,8-triol |
|---|---|
| PubChem CID | 123578018 |
| Molecular Formula | C11H23ClO4 |
| Molecular Weight | 254.75 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 6-chloro-5-(3-hydroxypropyl)octane-1,4,8-triol |
| SMILES | OCCCC(O)C(CCCO)C(Cl)CCO |
| InChI | InChI=1S/C11H23ClO4/c12-10(5-8-15)9(3-1-6-13)11(16)4-2-7-14/h9-11,13-16H,1-8H2 |
| InChIKey | FNJCYJNTIRDJFH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.75 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|