C10H20Cl2O4 — CID 19107662
4,5-dichlorodecane-1,3,6,10-tetrol (PubChem CID 19107662) has the molecular formula C10H20Cl2O4 and a molecular weight of 275.17 g/mol. Its IUPAC name is 4,5-dichlorodecane-1,3,6,10-tetrol.
| Compound Name | 4,5-dichlorodecane-1,3,6,10-tetrol |
|---|---|
| PubChem CID | 19107662 |
| Molecular Formula | C10H20Cl2O4 |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 4,5-dichlorodecane-1,3,6,10-tetrol |
| SMILES | OCCCCC(O)C(Cl)C(Cl)C(O)CCO |
| InChI | InChI=1S/C10H20Cl2O4/c11-9(7(15)3-1-2-5-13)10(12)8(16)4-6-14/h7-10,13-16H,1-6H2 |
| InChIKey | MYKWICPIDDQAAF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|