About 5-chlorononane-1,9-diol
5-chlorononane-1,9-diol (PubChem CID 87402424) has the molecular formula C9H19ClO2
and a molecular weight of 194.70 g/mol. Its IUPAC name is 5-chlorononane-1,9-diol.
Molecular Properties
| Compound Name | 5-chlorononane-1,9-diol |
| PubChem CID | 87402424 |
| Molecular Formula | C9H19ClO2 |
| Molecular Weight | 194.70 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 5-chlorononane-1,9-diol |
| SMILES | OCCCCC(Cl)CCCCO |
| InChI | InChI=1S/C9H19ClO2/c10-9(5-1-3-7-11)6-2-4-8-12/h9,11-12H,1-8H2 |
| InChIKey | GWRRPUGXBMIUDC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.70 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chlorononane-1,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chlorononane-1,9-diol?
The IUPAC name of 5-chlorononane-1,9-diol (CID 87402424) is 5-chlorononane-1,9-diol.
What is the SMILES notation for 5-chlorononane-1,9-diol?
The canonical SMILES for 5-chlorononane-1,9-diol is OCCCCC(Cl)CCCCO.
What is the InChIKey of 5-chlorononane-1,9-diol?
The InChIKey is GWRRPUGXBMIUDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19ClO2/c10-9(5-1-3-7-11)6-2-4-8-12/h9,11-12H,1-8H2.
What are the key properties of 5-chlorononane-1,9-diol?
5-chlorononane-1,9-diol has a molecular weight of 194.70 g/mol, XLogP of 1.92, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chlorononane-1,9-diol is sourced from PubChem (CID 87402424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).