C19H26O6 — CID 16758265
(1R,6Z,8R,13Z,15R,16S,19S)-19-hydroxy-8,15-dimethyl-3,10,20-trioxabicyclo[14.3.1]icosa-6,13,17-triene-4,11-dione (PubChem CID 16758265) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is (1R,6Z,8R,13Z,15R,16S,19S)-19-hydroxy-8,15-dimethyl-3,10,20-trioxabicyclo[14.3.1]icosa-6,13,17-triene-4,11-dione.
| Compound Name | (1R,6Z,8R,13Z,15R,16S,19S)-19-hydroxy-8,15-dimethyl-3,10,20-trioxabicyclo[14.3.1]icosa-6,13,17-triene-4,11-dione |
|---|---|
| PubChem CID | 16758265 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (1R,6Z,8R,13Z,15R,16S,19S)-19-hydroxy-8,15-dimethyl-3,10,20-trioxabicyclo[14.3.1]icosa-6,13,17-triene-4,11-dione |
| SMILES | C[C@@H]1/C=C\CC(=O)OC[C@H]2O[C@@H](C=C[C@@H]2O)[C@H](C)/C=C\CC(=O)OC1 |
| InChI | InChI=1S/C19H26O6/c1-13-5-3-7-19(22)24-12-17-15(20)9-10-16(25-17)14(2)6-4-8-18(21)23-11-13/h3-6,9-10,13-17,20H,7-8,11-12H2,1-2H3/b5-3-,6-4-/t13-,14-,15+,16+,17-/m1/s1 |
| InChIKey | XGCIFHVYKNFEON-LQQYVMJKSA-N |
| XLogP | 1.94 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|