C27H35NO8S — CID 6419596
N-[(1R,6E,8R,9S,14E,16R,17S,20S)-20-hydroxy-8,16-dimethyl-4,12-dioxo-3,11,21-trioxabicyclo[15.3.1]henicosa-6,14,18-trien-9-yl]-4-methylbenzenesulfonamide (PubChem CID 6419596) has the molecular formula C27H35NO8S and a molecular weight of 533.64 g/mol. Its IUPAC name is N-[(1R,6E,8R,9S,14E,16R,17S,20S)-20-hydroxy-8,16-dimethyl-4,12-dioxo-3,11,21-trioxabicyclo[15.3.1]henicosa-6,14,18-trien-9-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,6E,8R,9S,14E,16R,17S,20S)-20-hydroxy-8,16-dimethyl-4,12-dioxo-3,11,21-trioxabicyclo[15.3.1]henicosa-6,14,18-trien-9-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 6419596 |
| Molecular Formula | C27H35NO8S |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | N-[(1R,6E,8R,9S,14E,16R,17S,20S)-20-hydroxy-8,16-dimethyl-4,12-dioxo-3,11,21-trioxabicyclo[15.3.1]henicosa-6,14,18-trien-9-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2COC(=O)C/C=C/[C@@H](C)[C@@H]3C=C[C@H](O)[C@@H](COC(=O)C/C=C/[C@H]2C)O3)cc1 |
| InChI | InChI=1S/C27H35NO8S/c1-18-10-12-21(13-11-18)37(32,33)28-22-16-34-26(30)9-5-7-20(3)24-15-14-23(29)25(36-24)17-35-27(31)8-4-6-19(22)2/h4-7,10-15,19-20,22-25,28-29H,8-9,16-17H2,1-3H3/b6-4+,7-5+/t19-,20-,22-,23+,24+,25-/m1/s1 |
| InChIKey | CKGNPKQTHORKOH-UKMQGTHHSA-N |
| XLogP | 2.59 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|