C7H12FO10PS2 — CID 167605600
2-fluoro-1,3,2-dioxaphospholane;2,4,8,10-tetraoxa-3λ6,9λ6-dithiaspiro[5.5]undecane 3,3,9,9-tetraoxide (PubChem CID 167605600) has the molecular formula C7H12FO10PS2 and a molecular weight of 370.27 g/mol. Its IUPAC name is 2-fluoro-1,3,2-dioxaphospholane;2,4,8,10-tetraoxa-3λ6,9λ6-dithiaspiro[5.5]undecane 3,3,9,9-tetraoxide.
| Compound Name | 2-fluoro-1,3,2-dioxaphospholane;2,4,8,10-tetraoxa-3λ6,9λ6-dithiaspiro[5.5]undecane 3,3,9,9-tetraoxide |
|---|---|
| PubChem CID | 167605600 |
| Molecular Formula | C7H12FO10PS2 |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 2-fluoro-1,3,2-dioxaphospholane;2,4,8,10-tetraoxa-3λ6,9λ6-dithiaspiro[5.5]undecane 3,3,9,9-tetraoxide |
| SMILES | FP1OCCO1.O=S1(=O)OCC2(CO1)COS(=O)(=O)OC2 |
| InChI | InChI=1S/C5H8O8S2.C2H4FO2P/c6-14(7)10-1-5(2-11-14)3-12-15(8,9)13-4-5;3-6-4-1-2-5-6/h1-4H2;1-2H2 |
| InChIKey | KIJLZQIRTUKPEA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|