C3H2O9S2 — CID 137411723
2,2,7,7-tetraoxo-1,3,6,8-tetraoxa-2λ6,7λ6-dithiaspiro[4.4]nonan-4-one (PubChem CID 137411723) has the molecular formula C3H2O9S2 and a molecular weight of 246.17 g/mol. Its IUPAC name is 2,2,7,7-tetraoxo-1,3,6,8-tetraoxa-2λ6,7λ6-dithiaspiro[4.4]nonan-4-one.
| Compound Name | 2,2,7,7-tetraoxo-1,3,6,8-tetraoxa-2λ6,7λ6-dithiaspiro[4.4]nonan-4-one |
|---|---|
| PubChem CID | 137411723 |
| Molecular Formula | C3H2O9S2 |
| Molecular Weight | 246.17 g/mol |
| Exact Mass | 245.91 |
| IUPAC Name | 2,2,7,7-tetraoxo-1,3,6,8-tetraoxa-2λ6,7λ6-dithiaspiro[4.4]nonan-4-one |
| SMILES | O=C1OS(=O)(=O)OC12COS(=O)(=O)O2 |
| InChI | InChI=1S/C3H2O9S2/c4-2-3(12-14(7,8)10-2)1-9-13(5,6)11-3/h1H2 |
| InChIKey | JKKLQZGOLWQTFI-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.17 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |