C7H8O11S2 — CID 170116251
6-(2,2-dioxo-1,3,2-dioxathiolan-4-yl)-2,2-dioxo-1,3,7,9-tetraoxa-2λ6-thiaspiro[4.5]decan-8-one (PubChem CID 170116251) has the molecular formula C7H8O11S2 and a molecular weight of 332.26 g/mol. Its IUPAC name is 6-(2,2-dioxo-1,3,2-dioxathiolan-4-yl)-2,2-dioxo-1,3,7,9-tetraoxa-2λ6-thiaspiro[4.5]decan-8-one.
| Compound Name | 6-(2,2-dioxo-1,3,2-dioxathiolan-4-yl)-2,2-dioxo-1,3,7,9-tetraoxa-2λ6-thiaspiro[4.5]decan-8-one |
|---|---|
| PubChem CID | 170116251 |
| Molecular Formula | C7H8O11S2 |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 6-(2,2-dioxo-1,3,2-dioxathiolan-4-yl)-2,2-dioxo-1,3,7,9-tetraoxa-2λ6-thiaspiro[4.5]decan-8-one |
| SMILES | O=C1OCC2(COS(=O)(=O)O2)C(C2COS(=O)(=O)O2)O1 |
| InChI | InChI=1S/C7H8O11S2/c8-6-13-2-7(3-15-20(11,12)18-7)5(16-6)4-1-14-19(9,10)17-4/h4-5H,1-3H2 |
| InChIKey | GZDMKGLOGQCOPD-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |