C9H10O9S — CID 167202576
3,3-dioxo-1-(2-oxo-1,3-dioxolan-4-yl)-2,7,9-trioxa-3λ6-thiaspiro[4.5]decan-8-one (PubChem CID 167202576) has the molecular formula C9H10O9S and a molecular weight of 294.24 g/mol. Its IUPAC name is 3,3-dioxo-1-(2-oxo-1,3-dioxolan-4-yl)-2,7,9-trioxa-3λ6-thiaspiro[4.5]decan-8-one.
| Compound Name | 3,3-dioxo-1-(2-oxo-1,3-dioxolan-4-yl)-2,7,9-trioxa-3λ6-thiaspiro[4.5]decan-8-one |
|---|---|
| PubChem CID | 167202576 |
| Molecular Formula | C9H10O9S |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 3,3-dioxo-1-(2-oxo-1,3-dioxolan-4-yl)-2,7,9-trioxa-3λ6-thiaspiro[4.5]decan-8-one |
| SMILES | O=C1OCC2(CO1)CS(=O)(=O)OC2C1COC(=O)O1 |
| InChI | InChI=1S/C9H10O9S/c10-7-15-2-9(3-16-7)4-19(12,13)18-6(9)5-1-14-8(11)17-5/h5-6H,1-4H2 |
| InChIKey | FZMKKZHKRYTTMX-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|