C7H6O7 — CID 171753799
(1S,2R,6R,8R)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dione (PubChem CID 171753799) has the molecular formula C7H6O7 and a molecular weight of 202.12 g/mol. Its IUPAC name is (1S,2R,6R,8R)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dione.
| Compound Name | (1S,2R,6R,8R)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dione |
|---|---|
| PubChem CID | 171753799 |
| Molecular Formula | C7H6O7 |
| Molecular Weight | 202.12 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | (1S,2R,6R,8R)-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dione |
| SMILES | O=C1OC[C@H]2O[C@@H]3OC(=O)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C7H6O7/c8-6-10-1-2-3(12-6)4-5(11-2)14-7(9)13-4/h2-5H,1H2/t2-,3+,4-,5-/m1/s1 |
| InChIKey | HXHBPEIVUQEZLM-KKQCNMDGSA-N |
| XLogP | -0.22 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.12 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |