C10H16O7Si — CID 153490130
4-(2-oxo-1,3-dioxolan-4-yl)-5-(trimethylsilyloxymethyl)-1,3-dioxolan-2-one (PubChem CID 153490130) has the molecular formula C10H16O7Si and a molecular weight of 276.32 g/mol. Its IUPAC name is 4-(2-oxo-1,3-dioxolan-4-yl)-5-(trimethylsilyloxymethyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(2-oxo-1,3-dioxolan-4-yl)-5-(trimethylsilyloxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 153490130 |
| Molecular Formula | C10H16O7Si |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-(2-oxo-1,3-dioxolan-4-yl)-5-(trimethylsilyloxymethyl)-1,3-dioxolan-2-one |
| SMILES | C[Si](C)(C)OCC1OC(=O)OC1C1COC(=O)O1 |
| InChI | InChI=1S/C10H16O7Si/c1-18(2,3)14-5-7-8(17-10(12)16-7)6-4-13-9(11)15-6/h6-8H,4-5H2,1-3H3 |
| InChIKey | TULLEPSUVMRHOX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|