C9H13NO7 — CID 163685791
4-(dimethylaminooxymethyl)-5-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one (PubChem CID 163685791) has the molecular formula C9H13NO7 and a molecular weight of 247.20 g/mol. Its IUPAC name is 4-(dimethylaminooxymethyl)-5-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one.
| Compound Name | 4-(dimethylaminooxymethyl)-5-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 163685791 |
| Molecular Formula | C9H13NO7 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 4-(dimethylaminooxymethyl)-5-(2-oxo-1,3-dioxolan-4-yl)-1,3-dioxolan-2-one |
| SMILES | CN(C)OCC1OC(=O)OC1C1COC(=O)O1 |
| InChI | InChI=1S/C9H13NO7/c1-10(2)14-4-6-7(17-9(12)16-6)5-3-13-8(11)15-5/h5-7H,3-4H2,1-2H3 |
| InChIKey | JOTMPTSOENHRDN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|