C11H17IO6 — CID 163528465
(2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl) 2-(dimethyl-λ3-iodanyl)-2-methylpropanoate (PubChem CID 163528465) has the molecular formula C11H17IO6 and a molecular weight of 372.16 g/mol. Its IUPAC name is (2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl) 2-(dimethyl-λ3-iodanyl)-2-methylpropanoate.
| Compound Name | (2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl) 2-(dimethyl-λ3-iodanyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 163528465 |
| Molecular Formula | C11H17IO6 |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | (2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl) 2-(dimethyl-λ3-iodanyl)-2-methylpropanoate |
| SMILES | CI(C)C(C)(C)C(=O)OC1OCC2OC(=O)OC21 |
| InChI | InChI=1S/C11H17IO6/c1-11(2,12(3)4)9(13)18-8-7-6(5-15-8)16-10(14)17-7/h6-8H,5H2,1-4H3 |
| InChIKey | DQWNEOBXHGKEOG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|