C8H15NO4 — CID 174867976
N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one (PubChem CID 174867976) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one.
| Compound Name | N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 174867976 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one |
| SMILES | CCC1COC(=O)O1.CN(C)C=O |
| InChI | InChI=1S/C5H8O3.C3H7NO/c1-2-4-3-7-5(6)8-4;1-4(2)3-5/h4H,2-3H2,1H3;3H,1-2H3 |
| InChIKey | GRTNEYVEBSIJPM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|