About N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one
N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one (PubChem CID 174867976) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one |
| PubChem CID | 174867976 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one |
| SMILES | CCC1COC(=O)O1.CN(C)C=O |
| InChI | InChI=1S/C5H8O3.C3H7NO/c1-2-4-3-7-5(6)8-4;1-4(2)3-5/h4H,2-3H2,1H3;3H,1-2H3 |
| InChIKey | GRTNEYVEBSIJPM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one?
The IUPAC name of N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one (CID 174867976) is N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one.
What is the SMILES notation for N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one?
The canonical SMILES for N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one is CCC1COC(=O)O1.CN(C)C=O.
What is the InChIKey of N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one?
The InChIKey is GRTNEYVEBSIJPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.C3H7NO/c1-2-4-3-7-5(6)8-4;1-4(2)3-5/h4H,2-3H2,1H3;3H,1-2H3.
What are the key properties of N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one?
N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one has a molecular weight of 189.21 g/mol, XLogP of 0.64, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;4-ethyl-1,3-dioxolan-2-one is sourced from PubChem (CID 174867976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).