C25H40O3 — CID 167614183
7-[3-[(5Z,8Z)-3-hydroxytetradeca-5,8-dien-1-ynyl]oxiran-2-yl]-3,3-dimethylheptan-2-one (PubChem CID 167614183) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is 7-[3-[(5Z,8Z)-3-hydroxytetradeca-5,8-dien-1-ynyl]oxiran-2-yl]-3,3-dimethylheptan-2-one.
| Compound Name | 7-[3-[(5Z,8Z)-3-hydroxytetradeca-5,8-dien-1-ynyl]oxiran-2-yl]-3,3-dimethylheptan-2-one |
|---|---|
| PubChem CID | 167614183 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 7-[3-[(5Z,8Z)-3-hydroxytetradeca-5,8-dien-1-ynyl]oxiran-2-yl]-3,3-dimethylheptan-2-one |
| SMILES | CCCCC/C=C\C/C=C\CC(O)C#CC1OC1CCCCC(C)(C)C(C)=O |
| InChI | InChI=1S/C25H40O3/c1-5-6-7-8-9-10-11-12-13-16-22(27)18-19-24-23(28-24)17-14-15-20-25(3,4)21(2)26/h9-10,12-13,22-24,27H,5-8,11,14-17,20H2,1-4H3/b10-9-,13-12- |
| InChIKey | GMVPTKCHBIKKEU-UTJQPWESSA-N |
| XLogP | 5.77 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|