C18H34N2O12-2 — CID 167663039
bis((3S)-5-(dimethylamino)-3-hydroxypentanoate);(2R,3S)-3-formyloxy-2,3-dihydroxypropanoic acid (PubChem CID 167663039) has the molecular formula C18H34N2O12-2 and a molecular weight of 470.47 g/mol. Its IUPAC name is bis((3S)-5-(dimethylamino)-3-hydroxypentanoate);(2R,3S)-3-formyloxy-2,3-dihydroxypropanoic acid.
| Compound Name | bis((3S)-5-(dimethylamino)-3-hydroxypentanoate);(2R,3S)-3-formyloxy-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 167663039 |
| Molecular Formula | C18H34N2O12-2 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | bis((3S)-5-(dimethylamino)-3-hydroxypentanoate);(2R,3S)-3-formyloxy-2,3-dihydroxypropanoic acid |
| SMILES | CN(C)CC[C@H](O)CC(=O)[O-].CN(C)CC[C@H](O)CC(=O)[O-].O=CO[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/2C7H15NO3.C4H6O6/c2*1-8(2)4-3-6(9)5-7(10)11;5-1-10-4(9)2(6)3(7)8/h2*6,9H,3-5H2,1-2H3,(H,10,11);1-2,4,6,9H,(H,7,8)/p-2/t2*6-;2-,4-/m000/s1 |
| InChIKey | SFMCFESHLGYHPN-ZTIUJIBMSA-L |
| XLogP | -5.20 |
| TPSA | 231.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | -5.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|