C32H44BBrN6O6P2 — CID 167663495
3-bromo-6-methoxypyridazine;2-dimethylphosphoryl-4-(6-methoxypyridazin-3-yl)aniline;2-dimethylphosphoryl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 167663495) has the molecular formula C32H44BBrN6O6P2 and a molecular weight of 761.40 g/mol. Its IUPAC name is 3-bromo-6-methoxypyridazine;2-dimethylphosphoryl-4-(6-methoxypyridazin-3-yl)aniline;2-dimethylphosphoryl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 3-bromo-6-methoxypyridazine;2-dimethylphosphoryl-4-(6-methoxypyridazin-3-yl)aniline;2-dimethylphosphoryl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 167663495 |
| Molecular Formula | C32H44BBrN6O6P2 |
| Molecular Weight | 761.40 g/mol |
| Exact Mass | 760.21 |
| IUPAC Name | 3-bromo-6-methoxypyridazine;2-dimethylphosphoryl-4-(6-methoxypyridazin-3-yl)aniline;2-dimethylphosphoryl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2ccc(N)c(P(C)(C)=O)c2)OC1(C)C.COc1ccc(-c2ccc(N)c(P(C)(C)=O)c2)nn1.COc1ccc(Br)nn1 |
| InChI | InChI=1S/C14H23BNO3P.C13H16N3O2P.C5H5BrN2O/c1-13(2)14(3,4)19-15(18-13)10-7-8-11(16)12(9-10)20(5,6)17;1-18-13-7-6-11(15-16-13)9-4-5-10(14)12(8-9)19(2,3)17;1-9-5-3-2-4(6)7-8-5/h7-9H,16H2,1-6H3;4-8H,14H2,1-3H3;2-3H,1H3 |
| InChIKey | SHFLIHVTHGKEMJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 174.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|