C21H32N4O4S — CID 167744090
1-[4-[[[4-(aminomethyl)-5,5-dimethyl-1,1-dioxothiolane-2-carbonyl]amino]methyl]phenyl]piperidine-4-carboxamide (PubChem CID 167744090) has the molecular formula C21H32N4O4S and a molecular weight of 436.58 g/mol. Its IUPAC name is 1-[4-[[[4-(aminomethyl)-5,5-dimethyl-1,1-dioxothiolane-2-carbonyl]amino]methyl]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[[4-(aminomethyl)-5,5-dimethyl-1,1-dioxothiolane-2-carbonyl]amino]methyl]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 167744090 |
| Molecular Formula | C21H32N4O4S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1-[4-[[[4-(aminomethyl)-5,5-dimethyl-1,1-dioxothiolane-2-carbonyl]amino]methyl]phenyl]piperidine-4-carboxamide |
| SMILES | CC1(C)C(CN)CC(C(=O)NCc2ccc(N3CCC(C(N)=O)CC3)cc2)S1(=O)=O |
| InChI | InChI=1S/C21H32N4O4S/c1-21(2)16(12-22)11-18(30(21,28)29)20(27)24-13-14-3-5-17(6-4-14)25-9-7-15(8-10-25)19(23)26/h3-6,15-16,18H,7-13,22H2,1-2H3,(H2,23,26)(H,24,27) |
| InChIKey | ZOIPFHKXRNLLJR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|