C15H22ClNO4S — CID 167744899
5-chloro-2-(2-methoxyethoxy)-N-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]aniline (PubChem CID 167744899) has the molecular formula C15H22ClNO4S and a molecular weight of 347.86 g/mol. Its IUPAC name is 5-chloro-2-(2-methoxyethoxy)-N-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]aniline.
| Compound Name | 5-chloro-2-(2-methoxyethoxy)-N-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]aniline |
|---|---|
| PubChem CID | 167744899 |
| Molecular Formula | C15H22ClNO4S |
| Molecular Weight | 347.86 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 5-chloro-2-(2-methoxyethoxy)-N-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]aniline |
| SMILES | COCCOc1ccc(Cl)cc1NCC1(CS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H22ClNO4S/c1-20-7-8-21-14-4-3-12(16)9-13(14)17-10-15(5-6-15)11-22(2,18)19/h3-4,9,17H,5-8,10-11H2,1-2H3 |
| InChIKey | KBQGTGZPLKTZTE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.86 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|