C13H19ClO6S — CID 22011430
2-chloro-1,3-bis(2-methoxyethoxy)-4-methylsulfonylbenzene (PubChem CID 22011430) has the molecular formula C13H19ClO6S and a molecular weight of 338.81 g/mol. Its IUPAC name is 2-chloro-1,3-bis(2-methoxyethoxy)-4-methylsulfonylbenzene.
| Compound Name | 2-chloro-1,3-bis(2-methoxyethoxy)-4-methylsulfonylbenzene |
|---|---|
| PubChem CID | 22011430 |
| Molecular Formula | C13H19ClO6S |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-chloro-1,3-bis(2-methoxyethoxy)-4-methylsulfonylbenzene |
| SMILES | COCCOc1ccc(S(C)(=O)=O)c(OCCOC)c1Cl |
| InChI | InChI=1S/C13H19ClO6S/c1-17-6-8-19-10-4-5-11(21(3,15)16)13(12(10)14)20-9-7-18-2/h4-5H,6-9H2,1-3H3 |
| InChIKey | OGGRGSSFJIODFE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|