C10H11F3N6O3S — CID 167747497
N-(1-ethyltriazol-4-yl)sulfonyl-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 167747497) has the molecular formula C10H11F3N6O3S and a molecular weight of 352.30 g/mol. Its IUPAC name is N-(1-ethyltriazol-4-yl)sulfonyl-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-(1-ethyltriazol-4-yl)sulfonyl-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 167747497 |
| Molecular Formula | C10H11F3N6O3S |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N-(1-ethyltriazol-4-yl)sulfonyl-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CCn1cc(S(=O)(=O)NC(=O)c2cc(C(F)(F)F)nn2C)nn1 |
| InChI | InChI=1S/C10H11F3N6O3S/c1-3-19-5-8(14-17-19)23(21,22)16-9(20)6-4-7(10(11,12)13)15-18(6)2/h4-5H,3H2,1-2H3,(H,16,20) |
| InChIKey | CVLSURZPDVTZPR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |