C12H9Cl2N5O3S — CID 167775179
3,5-dichloro-2-hydroxy-N-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)benzenesulfonamide (PubChem CID 167775179) has the molecular formula C12H9Cl2N5O3S and a molecular weight of 374.21 g/mol. Its IUPAC name is 3,5-dichloro-2-hydroxy-N-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-2-hydroxy-N-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 167775179 |
| Molecular Formula | C12H9Cl2N5O3S |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 3,5-dichloro-2-hydroxy-N-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1nc2ncccn2n1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H9Cl2N5O3S/c13-7-4-8(14)11(20)9(5-7)23(21,22)16-6-10-17-12-15-2-1-3-19(12)18-10/h1-5,16,20H,6H2 |
| InChIKey | LLFOHQRLGVJZKH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|