C16H11F3N6O2 — CID 167803553
(2,6-diamino-7H-purin-8-yl)methyl 3-ethynyl-5-(trifluoromethyl)benzoate (PubChem CID 167803553) has the molecular formula C16H11F3N6O2 and a molecular weight of 376.30 g/mol. Its IUPAC name is (2,6-diamino-7H-purin-8-yl)methyl 3-ethynyl-5-(trifluoromethyl)benzoate.
| Compound Name | (2,6-diamino-7H-purin-8-yl)methyl 3-ethynyl-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 167803553 |
| Molecular Formula | C16H11F3N6O2 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (2,6-diamino-7H-purin-8-yl)methyl 3-ethynyl-5-(trifluoromethyl)benzoate |
| SMILES | C#Cc1cc(C(=O)OCc2nc3nc(N)nc(N)c3[nH]2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F3N6O2/c1-2-7-3-8(5-9(4-7)16(17,18)19)14(26)27-6-10-22-11-12(20)24-15(21)25-13(11)23-10/h1,3-5H,6H2,(H5,20,21,22,23,24,25) |
| InChIKey | VPJDUMRREQKNGO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|