C23H20N4O5 — CID 167827446
N-(6,7-dihydro-5H-cyclopenta[c]pyridin-4-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-carboxamide (PubChem CID 167827446) has the molecular formula C23H20N4O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-cyclopenta[c]pyridin-4-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-carboxamide.
| Compound Name | N-(6,7-dihydro-5H-cyclopenta[c]pyridin-4-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-carboxamide |
|---|---|
| PubChem CID | 167827446 |
| Molecular Formula | C23H20N4O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-(6,7-dihydro-5H-cyclopenta[c]pyridin-4-ylmethyl)-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole-4-carboxamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(C(=O)NCc4cncc5c4CCC5)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H20N4O5/c28-18-8-7-17(21(30)26-18)27-22(31)16-6-2-5-15(19(16)23(27)32)20(29)25-11-13-10-24-9-12-3-1-4-14(12)13/h2,5-6,9-10,17H,1,3-4,7-8,11H2,(H,25,29)(H,26,28,30) |
| InChIKey | QPOAKDZKMXCUST-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|